Difference between revisions of "CPDQT-39"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o...") |
(Created page with "Category:metabolite == Metabolite CPDQT-39 == * common-name: ** 3-[(6'-methylthio)hexyl]malate * smiles: ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** lqqzhlhcfscjc...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-39 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-[(6'-methylthio)hexyl]malate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** csccccccc(c(o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lqqzhlhcfscjcu-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 262.32 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18202]] |
| − | + | * [[RXNQT-4174]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-18202]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-[(6'-methylthio)hexyl]malate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lqqzhlhcfscjcu-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=262.32}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPDQT-39
- common-name:
- 3-[(6'-methylthio)hexyl]malate
- smiles:
- csccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- lqqzhlhcfscjcu-uhfffaoysa-l
- molecular-weight:
- 262.32
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(6'-methylthio)hexyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
