Difference between revisions of "CPDQT-39"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10615 RXN-10615] == * direction: ** left-to-right * common-name: ** aryl sulfotransferase ** su...")
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10615 RXN-10615] ==
+
== Metabolite PRPP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** aryl sulfotransferase
+
** 5-phospho-α-d-ribose 1-diphosphate
−
** sulfotransferase
+
* smiles:
−
* ec-number:
+
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
−
** [http://enzyme.expasy.org/EC/2.8.2.1 ec-2.8.2.1]
+
* inchi-key:
−
== Reaction formula ==
+
** pqgcedqwhsbajp-txicztdvsa-i
−
* 1 [[LIOTHYRONINE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[CPD-11408]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 385.031
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ19194]]
+
* [[ADENPRIBOSYLTRAN-RXN]]
−
** Category: [[annotation]]
+
* [[ADPART]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[APPRT]]
−
* Gene: [[SJ06276]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[HPRT]]
−
* Gene: [[SJ01900]]
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
−
** Category: [[annotation]]
+
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[OROPRIBTRANS-RXN]]
−
** Category: [[orthology]]
+
* [[ORPRT]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PRPPAMIDOTRANS-RXN]]
−
* Gene: [[SJ10094]]
+
* [[PRPPSYN-RXN]]
−
** Category: [[annotation]]
+
* [[PRTRANS-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[QUINOPRIBOTRANS-RXN]]
−
* Gene: [[SJ07550]]
+
* [[RPDPK]]
−
** Category: [[annotation]]
+
* [[RXN-14270]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[URACIL-PRIBOSYLTRANS-RXN]]
−
** Category: [[orthology]]
+
* [[XPPRT]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ00192]]
+
* [[APPRT]]
−
** Category: [[annotation]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
* Gene: [[SJ05841]]
+
* [[HPRT]]
−
** Category: [[annotation]]
+
* [[OROPRIBTRANS-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ORPRT]]
−
</div>
+
* [[PRPPAMIDOTRANS-RXN]]
−
== Pathway(s)  ==
+
* [[PRPPSYN-RXN]]
−
* [[PWY-6261]], thyroid hormone metabolism II (via conjugation and/or degradation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261]
+
* [[PRTRANS-RXN]]
−
** '''10''' reactions found over '''15''' reactions in the full pathway
+
* [[R5PDP]]
−
== Reconstruction information  ==
+
* [[RPDPK]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[XPPRT]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=5-phospho-&alpha;-d-ribose 1-diphosphate}}
−
{{#set: direction=left-to-right}}
+
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}
−
{{#set: common-name=sulfotransferase|aryl sulfotransferase}}
+
{{#set: molecular-weight=385.031}}
−
{{#set: ec-number=ec-2.8.2.1}}
 
−
{{#set: nb gene associated=7}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite PRPP

  • common-name:
    • 5-phospho-α-d-ribose 1-diphosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
  • inchi-key:
    • pqgcedqwhsbajp-txicztdvsa-i
  • molecular-weight:
    • 385.031

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPDQT-39&oldid=47332"