Difference between revisions of "CPDQT-39"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o...")
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYL-D-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine * smiles: ** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PRPP ==
+
== Metabolite UDP-N-ACETYL-D-GLUCOSAMINE ==
 
* common-name:
 
* common-name:
** 5-phospho-α-d-ribose 1-diphosphate
+
** udp-n-acetyl-α-d-glucosamine
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
+
** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
 
* inchi-key:
 
* inchi-key:
** pqgcedqwhsbajp-txicztdvsa-i
+
** lftytuazoprmmi-cfrasdgpsa-l
 
* molecular-weight:
 
* molecular-weight:
** 385.031
+
** 605.342
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPRIBOSYLTRAN-RXN]]
+
* [[2.4.1.101-RXN]]
* [[ADPART]]
+
* [[2.4.1.141-RXN]]
* [[APPRT]]
+
* [[2.4.1.145-RXN]]
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[2.4.1.155-RXN]]
* [[GUANPRIBOSYLTRAN-RXN]]
+
* [[2.4.1.198-RXN]]
* [[HPRT]]
+
* [[2.4.1.201-RXN]]
* [[HYPOXANPRIBOSYLTRAN-RXN]]
+
* [[2.4.1.223-RXN]]
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
+
* [[2.4.1.224-RXN]]
* [[OROPRIBTRANS-RXN]]
+
* [[2.4.1.229-RXN]]
* [[ORPRT]]
+
* [[2.4.1.94-RXN]]
* [[PRPPAMIDOTRANS-RXN]]
+
* [[2.7.8.15-RXN]]
* [[PRPPSYN-RXN]]
+
* [[2.7.8.17-RXN]]
* [[PRTRANS-RXN]]
+
* [[RXN-11627]]
* [[QUINOPRIBOTRANS-RXN]]
+
* [[RXN-11889]]
* [[RPDPK]]
+
* [[RXN-11890]]
* [[RXN-14270]]
+
* [[RXN-15205]]
* [[URACIL-PRIBOSYLTRANS-RXN]]
+
* [[RXN-6501]]
* [[XPPRT]]
+
* [[RXN-7873]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[APPRT]]
+
* [[2.4.1.198-RXN]]
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[2.4.1.229-RXN]]
* [[GUANPRIBOSYLTRAN-RXN]]
+
* [[2.4.1.94-RXN]]
* [[HPRT]]
+
* [[NAG1P-URIDYLTRANS-RXN]]
* [[OROPRIBTRANS-RXN]]
+
* [[RXN-11627]]
* [[ORPRT]]
+
* [[RXN-11889]]
* [[PRPPAMIDOTRANS-RXN]]
+
* [[RXN-11890]]
* [[PRPPSYN-RXN]]
+
* [[RXN-7873]]
* [[PRTRANS-RXN]]
+
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
* [[R5PDP]]
 
* [[RPDPK]]
 
* [[XPPRT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-phospho-α-d-ribose 1-diphosphate}}
+
{{#set: common-name=udp-n-acetyl-α-d-glucosamine}}
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}
+
{{#set: inchi-key=inchikey=lftytuazoprmmi-cfrasdgpsa-l}}
{{#set: molecular-weight=385.031}}
+
{{#set: molecular-weight=605.342}}

Revision as of 14:57, 5 January 2021

Metabolite UDP-N-ACETYL-D-GLUCOSAMINE

  • common-name:
    • udp-n-acetyl-α-d-glucosamine
  • smiles:
    • cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
  • inchi-key:
    • lftytuazoprmmi-cfrasdgpsa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality