Difference between revisions of "CPDQT-4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R621-RXN R621-RXN] == * direction: ** left-to-right * common-name: ** nitric oxide dioxygenase * ec...")
(Created page with "Category:metabolite == Metabolite CPDQT-4 == * common-name: ** β-l-galactose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1) * inchi-key: ** hxxfsf...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R621-RXN R621-RXN] ==
+
== Metabolite CPDQT-4 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** nitric oxide dioxygenase
+
** β-l-galactose 1-phosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.12.17 ec-1.14.12.17]
+
** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1)
== Reaction formula ==
+
* inchi-key:
* 1 [[NADH-P-OR-NOP]][c] '''+''' 2 [[NITRIC-OXIDE]][c] '''+''' 2 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[NAD-P-OR-NOP]][c] '''+''' 2 [[NITRATE]][c] '''+''' 1 [[PROTON]][c]
+
** hxxfsfrbohsimq-sxuwkvjysa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ15480]]
+
** 258.121
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXNQT-4142]]
* Gene: [[SJ06442]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN4FS-12]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN4FS-13]]
== Pathway(s) ==
+
* [[RXNQT-4141]]
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=β-l-galactose 1-phosphate}}
== External links  ==
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-sxuwkvjysa-l}}
* LIGAND-RXN:
+
{{#set: molecular-weight=258.121}}
** [http://www.genome.jp/dbget-bin/www_bget?R05724 R05724]
 
** [http://www.genome.jp/dbget-bin/www_bget?R05725 R05725]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=nitric oxide dioxygenase}}
 
{{#set: ec-number=ec-1.14.12.17}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPDQT-4

  • common-name:
    • β-l-galactose 1-phosphate
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1)
  • inchi-key:
    • hxxfsfrbohsimq-sxuwkvjysa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality