Difference between revisions of "CPDQT-4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12457 RXN-12457] == * direction: ** left-to-right * common-name: ** trna-dihydrouridine47 synth...")
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12457 RXN-12457] ==
+
== Metabolite DIHYDROXYNAPHTHOATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** trna-dihydrouridine47 synthase
+
** 2-carboxy-1,4-naphthoquinol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.89 ec-1.3.1.89]
+
** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Uracil47-in-tRNAs]][c] '''=>''' 1 [[56-Dihydrouracil47-in-tRNAs]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
+
** vojuxhhacrxltd-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07722]]
+
** 203.174
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[NPHS]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2-carboxy-1,4-naphthoquinol}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=vojuxhhacrxltd-uhfffaoysa-m}}
−
* RHEA:
+
{{#set: molecular-weight=203.174}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=53362 53362]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=trna-dihydrouridine47 synthase}}
 
−
{{#set: ec-number=ec-1.3.1.89}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite DIHYDROXYNAPHTHOATE

  • common-name:
    • 2-carboxy-1,4-naphthoquinol
  • smiles:
    • c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
  • inchi-key:
    • vojuxhhacrxltd-uhfffaoysa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPDQT-4&oldid=47701"