Difference between revisions of "CPDQT-41"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * smiles: ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) * in...")
(Created page with "Category:metabolite == Metabolite Peptides-with-Leader-Sequence == * common-name: ** a peptide with a leader sequence == Reaction(s) known to consume the compound == * 3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-CHLORO-24-DINITROBENZENE ==
+
== Metabolite Peptides-with-Leader-Sequence ==
 
* common-name:
 
* common-name:
** 1-chloro-2,4-dinitrobenzene
+
** a peptide with a leader sequence
* smiles:
 
** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
 
* inchi-key:
 
** vyzahlcbvhpddf-uhfffaoysa-n
 
* molecular-weight:
 
** 202.554
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GST-RXN]]
+
* [[3.4.21.89-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GST-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-chloro-2,4-dinitrobenzene}}
+
{{#set: common-name=a peptide with a leader sequence}}
{{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}}
 
{{#set: molecular-weight=202.554}}
 

Revision as of 18:58, 14 January 2021

Metabolite Peptides-with-Leader-Sequence

  • common-name:
    • a peptide with a leader sequence

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality