Difference between revisions of "CPDQT-41"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * smiles: ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) * in...") |
(Created page with "Category:metabolite == Metabolite CPDQT-41 == * common-name: ** 10-(methylthio)-2-oxodecanoate * smiles: ** csccccccccc(=o)c([o-])=o * inchi-key: ** iezwlijbcdcgeu-uhfffao...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-41 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 10-(methylthio)-2-oxodecanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** csccccccccc(=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iezwlijbcdcgeu-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 231.329 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXNQT-4178]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=10-(methylthio)-2-oxodecanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iezwlijbcdcgeu-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=231.329}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPDQT-41
- common-name:
- 10-(methylthio)-2-oxodecanoate
- smiles:
- csccccccccc(=o)c([o-])=o
- inchi-key:
- iezwlijbcdcgeu-uhfffaoysa-m
- molecular-weight:
- 231.329
