Difference between revisions of "CREATINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D7-tetradecenoyl-ACPs == * common-name: ** a 3-oxo-cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite CREATINE == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi-key: ** cvsvtcorwbxhqv-uhfffaoysa-n * molecular-wei...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CREATINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** creatine |
| + | * smiles: | ||
| + | ** c(c(=o)[o-])n(c)c(n)=[n+] | ||
| + | * inchi-key: | ||
| + | ** cvsvtcorwbxhqv-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 131.134 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[CREATINASE-RXN]] |
| + | * [[CREATINE-KINASE-RXN]] | ||
| + | * [[CREATININASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[CREATINE-KINASE-RXN]] |
| + | * [[CREATININASE-RXN]] | ||
| + | * [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=creatine}} |
| + | {{#set: inchi-key=inchikey=cvsvtcorwbxhqv-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=131.134}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CREATINE
- common-name:
- creatine
- smiles:
- c(c(=o)[o-])n(c)c(n)=[n+]
- inchi-key:
- cvsvtcorwbxhqv-uhfffaoysa-n
- molecular-weight:
- 131.134
