|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ19809 == | + | == Metabolite CREATINE-P == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** nω-phosphocreatine |
| − | * right-end-position:
| + | * smiles: |
| − | ** 147186
| + | ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 138135 | + | ** drbbfclwyrjsjz-uhfffaoysa-l |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 62.824905
| + | ** 209.098 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[CREATINE-KINASE-RXN]] |
| − | == Reaction(s) associated ==
| + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | * [[CREATINE-KINASE-RXN]] |
| − | * [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=nω-phosphocreatine}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}} |
| − | * [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
| + | {{#set: molecular-weight=209.098}} |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[ALANINE-AMINOTRANSFERASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[D-ALANINE-AMINOTRANSFERASE-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[GLYCINE-AMINOTRANSFERASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-13698]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[GLYSYN-ALA-PWY]] | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[ALANINE-SYN2-PWY]] | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[ALANINE-DEG3-PWY]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[ALACAT2-PWY]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7117]]
| |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7115]]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-7383]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-181]]
| |
| − | ** '''5''' reactions found over '''9''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=147186}} | |
| − | {{#set: left-end-position=138135}}
| |
| − | {{#set: centisome-position=62.824905 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=6}}
| |
| − | {{#set: nb pathway associated=8}}
| |
