Difference between revisions of "CREATINE-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Phosphorylated-phosphoglucomutase == * common-name: ** a phosphorylated phosphoglucomutase == Reaction(s) known to consume the compound =...") |
(Created page with "Category:metabolite == Metabolite CREATINE-P == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] * inchi-key: ** drbbfclwyr...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CREATINE-P == |
* common-name: | * common-name: | ||
− | ** | + | ** nω-phosphocreatine |
+ | * smiles: | ||
+ | ** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+] | ||
+ | * inchi-key: | ||
+ | ** drbbfclwyrjsjz-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 209.098 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[CREATINE-KINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[CREATINE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=nω-phosphocreatine}} |
+ | {{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=209.098}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CREATINE-P
- common-name:
- nω-phosphocreatine
- smiles:
- c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
- inchi-key:
- drbbfclwyrjsjz-uhfffaoysa-l
- molecular-weight:
- 209.098