Difference between revisions of "CREATININE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlzydqjhkrmq-uhfffaoysa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite CREATININE == * common-name: ** creatinine * smiles: ** cn1(cc(=o)nc(=n)1) * inchi-key: ** ddrjaanprjihgj-uhfffaoysa-n * molecular-weight...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CREATININE == |
* common-name: | * common-name: | ||
| − | ** | + | ** creatinine |
* smiles: | * smiles: | ||
| − | ** | + | ** cn1(cc(=o)nc(=n)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ddrjaanprjihgj-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 113.119 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[CREATININASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CREATININASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=creatinine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ddrjaanprjihgj-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=113.119}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CREATININE
- common-name:
- creatinine
- smiles:
- cn1(cc(=o)nc(=n)1)
- inchi-key:
- ddrjaanprjihgj-uhfffaoysa-n
- molecular-weight:
- 113.119
