Difference between revisions of "CREATININE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19027 == * transcription-direction: ** positive * right-end-position: ** 216149 * left-end-position: ** 212985 * centisome-position: ** 91.58872...") |
(Created page with "Category:metabolite == Metabolite MALTOHEXAOSE == * common-name: ** maltohexaose * smiles: ** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite MALTOHEXAOSE == |
− | * | + | * common-name: |
− | ** | + | ** maltohexaose |
− | * | + | * smiles: |
− | ** | + | ** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o |
− | * | + | * inchi-key: |
− | ** | + | ** ocibbxpluvykch-liggpisvsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 990.867 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-14282]] | |
− | == Reaction(s) | + | * [[RXN-14285]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-14283]] |
− | + | * [[RXN-14286]] | |
− | + | * [[RXN0-5181]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=maltohexaose}} | |
− | * [[RXN- | + | {{#set: inchi-key=inchikey=ocibbxpluvykch-liggpisvsa-n}} |
− | + | {{#set: molecular-weight=990.867}} | |
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN0- | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite MALTOHEXAOSE
- common-name:
- maltohexaose
- smiles:
- c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o
- inchi-key:
- ocibbxpluvykch-liggpisvsa-n
- molecular-weight:
- 990.867