Difference between revisions of "CROTONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13884 == * transcription-direction: ** positive * right-end-position: ** 191335 * left-end-position: ** 172621 * centisome-position: ** 52.38336...")
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * smiles: ** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ13884 ==
+
== Metabolite CROTONYL-COA ==
* transcription-direction:
+
* common-name:
** positive
+
** crotonyl-coa
* right-end-position:
+
* smiles:
** 191335
+
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
* left-end-position:
+
* inchi-key:
** 172621
+
** kfwwcmjsysspsk-bogfjhsmsa-j
* centisome-position:
+
* molecular-weight:
** 52.38336   
+
** 831.577
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ACOAD1f]]
== Reaction(s) associated ==
+
* [[ACOAR1h]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
* [[3.6.4.5-RXN]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
** Category: [[annotation]]
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HBCHL]]
* [[ATPASE-RXN]]
+
* [[HBCHLm]]
** Category: [[annotation]]
+
* [[RXN-11667]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-12558]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[ACOA40OR]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[ACOAD1f]]
** Category: [[annotation]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
** Category: [[orthology]]
+
* [[HBCHL]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[HBCHLm]]
* [[RXN-12195]]
+
* [[RXN-11667]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=crotonyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=831.577}}
* [[RXN-12196]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN0-5462]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-7210]]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=191335}}
 
{{#set: left-end-position=172621}}
 
{{#set: centisome-position=52.38336    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=6}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CROTONYL-COA

  • common-name:
    • crotonyl-coa
  • smiles:
    • cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • kfwwcmjsysspsk-bogfjhsmsa-j
  • molecular-weight:
    • 831.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality