Difference between revisions of "CROTONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09599 == * transcription-direction: ** negative * right-end-position: ** 22386 * left-end-position: ** 1702 * centisome-position: ** 4.377122 =...")
 
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * smiles: ** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09599 ==
+
== Metabolite CROTONYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** crotonyl-coa
−
* right-end-position:
+
* smiles:
−
** 22386
+
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
−
* left-end-position:
+
* inchi-key:
−
** 1702
+
** kfwwcmjsysspsk-bogfjhsmsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 4.377122   
+
** 831.577
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ACOAD1f]]
−
== Reaction(s) associated ==
+
* [[ACOAR1h]]
−
* [[MEVALONATE-KINASE-RXN]]
+
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
−
** Category: [[annotation]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
−
== Pathway(s) associated ==
+
* [[HBCHL]]
−
* [[PWY-7391]]
+
* [[HBCHLm]]
−
** '''7''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-11667]]
−
* [[PWY-922]]
+
* [[RXN-12558]]
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6174]]
+
* [[ACOA40OR]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[ACOAD1f]]
−
{{#set: transcription-direction=negative}}
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
−
{{#set: right-end-position=22386}}
+
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
−
{{#set: left-end-position=1702}}
+
* [[HBCHL]]
−
{{#set: centisome-position=4.377122    }}
+
* [[HBCHLm]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-11667]]
−
{{#set: nb reaction associated=1}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: nb pathway associated=3}}
+
{{#set: common-name=crotonyl-coa}}
 +
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
 +
{{#set: molecular-weight=831.577}}

Latest revision as of 11:14, 18 March 2021

Metabolite CROTONYL-COA

  • common-name:
    • crotonyl-coa
  • smiles:
    • cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • kfwwcmjsysspsk-bogfjhsmsa-j
  • molecular-weight:
    • 831.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CROTONYL-COA&oldid=138191"