Difference between revisions of "CRPB-all-trans-Retinol"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8075 == * common-name: ** 1-18:2-2-16:1-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
(Created page with "Category:metabolite == Metabolite Sterol-3-beta-D-glucosides == * common-name: ** a sterol 3-β-d-glucoside == Reaction(s) known to consume the compound == == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8075 ==
+
== Metabolite Sterol-3-beta-D-glucosides ==
 
* common-name:
 
* common-name:
** 1-18:2-2-16:1-monogalactosyldiacylglycerol
+
** a sterol 3-β-d-glucoside
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
 
* inchi-key:
 
** hghvcqzwrzwqks-cphkdgevsa-n
 
* molecular-weight:
 
** 753.067
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8297]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-16:1-monogalactosyldiacylglycerol}}
+
{{#set: common-name=a sterol 3-β-d-glucoside}}
{{#set: inchi-key=inchikey=hghvcqzwrzwqks-cphkdgevsa-n}}
 
{{#set: molecular-weight=753.067}}
 

Revision as of 18:56, 14 January 2021

Metabolite Sterol-3-beta-D-glucosides

  • common-name:
    • a sterol 3-β-d-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality