Difference between revisions of "CTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] == * direction: ** left-to-right * common-name: ** [cys-gly]-s-conjugate dipepti...")
(Created page with "Category:metabolite == Metabolite CTP == * common-name: ** ctp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2)) * inchi-key: **...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6642 RXN-6642] ==
+
== Metabolite CTP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** [cys-gly]-s-conjugate dipeptidase
+
** ctp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.4.11.2 ec-3.4.11.2]
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-6262]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[GLY]][c] '''+''' 1 [[S-Substituted-L-Cysteines]][c]
+
** pcdqprrszkqhhs-xvfcmesisa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ10244]]
+
** 479.127
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.7.7.14-RXN]]
−
** Category: [[orthology]]
+
* [[2.7.7.15-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.7.7.60-RXN]]
−
== Pathway(s)  ==
+
* [[CDPDIGLYSYN-RXN]]
−
* [[PWY-6842]], glutathione-mediated detoxification II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6842 PWY-6842]
+
* [[CHLPCTDh]]
−
** '''5''' reactions found over '''9''' reactions in the full pathway
+
* [[DOLICHOL-KINASE-RXN]]
−
* [[PWY-4061]], glutathione-mediated detoxification I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061]
+
* [[P-PANTOCYSLIG-RXN]]
−
** '''4''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-12195]]
−
== Reconstruction information  ==
+
* [[RXN-12200]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-12959]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15091]]
−
== External links  ==
+
* [[RXN-7683]]
−
{{#set: direction=left-to-right}}
+
* [[RXN0-383]]
−
{{#set: common-name=[cys-gly]-s-conjugate dipeptidase}}
+
* [[RXN0-5515]]
−
{{#set: ec-number=ec-3.4.11.2}}
+
* [[RXN0-723]]
−
{{#set: nb gene associated=1}}
+
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
−
{{#set: nb pathway associated=2}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: reconstruction category=orthology|annotation}}
+
* [[ATCD]]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
* [[ATCDm]]
−
{{#set: reconstruction comment=n.a}}
+
* [[CDPKIN-RXN]]
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
+
* [[CTPSYN-RXN]]
 +
* [[RXN-14325]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=ctp}}
 +
{{#set: inchi-key=inchikey=pcdqprrszkqhhs-xvfcmesisa-j}}
 +
{{#set: molecular-weight=479.127}}

Latest revision as of 11:17, 18 March 2021

Metabolite CTP

  • common-name:
    • ctp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(n)=nc(=o)2))
  • inchi-key:
    • pcdqprrszkqhhs-xvfcmesisa-j
  • molecular-weight:
    • 479.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CTP&oldid=139357"