Difference between revisions of "CTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * smiles: ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
(Created page with "Category:metabolite == Metabolite IMINOASPARTATE == * common-name: ** 2-iminosuccinate * smiles: ** c(=o)([o-])cc(=n)c(=o)[o-] * inchi-key: ** nmuoatvllqeyhi-uhfffaoysa-l...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite IMINOASPARTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-iminosuccinate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])cc(=n)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nmuoatvllqeyhi-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 129.072 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[QUINOLINATE-SYNTHA-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[L-ASPARTATE-OXID-RXN]] |
| + | * [[RXN-9772]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-iminosuccinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nmuoatvllqeyhi-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=129.072}} |
Revision as of 08:30, 15 March 2021
Contents
Metabolite IMINOASPARTATE
- common-name:
- 2-iminosuccinate
- smiles:
- c(=o)([o-])cc(=n)c(=o)[o-]
- inchi-key:
- nmuoatvllqeyhi-uhfffaoysa-l
- molecular-weight:
- 129.072
