Difference between revisions of "CU+"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...") |
(Created page with "Category:metabolite == Metabolite CU+ == * common-name: ** cu+ * smiles: ** [cu+] * inchi-key: ** vmqmzmrvkuzkql-uhfffaoysa-n * molecular-weight: ** 64.554 == Reaction(s)...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CU+ == |
* common-name: | * common-name: | ||
| − | ** | + | ** cu+ |
* smiles: | * smiles: | ||
| − | ** | + | ** [cu+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vmqmzmrvkuzkql-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 64.554 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-CU+]] |
| − | + | * [[RXN-14455]] | |
| − | + | * [[TransportSeed-CU+]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ExchangeSeed-CU+]] |
| − | * [[ | + | * [[RXN-14455]] |
| − | + | * [[TransportSeed-CU+]] | |
| − | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cu+}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vmqmzmrvkuzkql-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=64.554}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CU+
- common-name:
- cu+
- smiles:
- [cu+]
- inchi-key:
- vmqmzmrvkuzkql-uhfffaoysa-n
- molecular-weight:
- 64.554
