Difference between revisions of "CU+"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Polynucleotide-Holder == * common-name: ** a generic polynucleotide substrate == Reaction(s) known to consume the compound == * 3.1.31....") |
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-725 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 13(s)-hpote |
| + | * smiles: | ||
| + | ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo | ||
| + | * inchi-key: | ||
| + | ** uyqgvdxdxbaabn-fqsphkrjsa-m | ||
| + | * molecular-weight: | ||
| + | ** 309.425 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1F-19]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-1321]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=13(s)-hpote}} |
| + | {{#set: inchi-key=inchikey=uyqgvdxdxbaabn-fqsphkrjsa-m}} | ||
| + | {{#set: molecular-weight=309.425}} | ||
Revision as of 14:58, 5 January 2021
Contents
Metabolite CPD-725
- common-name:
- 13(s)-hpote
- smiles:
- ccc=ccc(c=cc=ccccccccc([o-])=o)oo
- inchi-key:
- uyqgvdxdxbaabn-fqsphkrjsa-m
- molecular-weight:
- 309.425
