Difference between revisions of "CU+"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-725 == * common-name: ** 13(s)-hpote * smiles: ** ccc=ccc(c=cc=ccccccccc([o-])=o)oo * inchi-key: ** uyqgvdxdxbaabn-fqsphkrjsa-m * mol...")
(Created page with "Category:metabolite == Metabolite CPD-248 == * common-name: ** 2-formylaminobenzaldehyde * smiles: ** c(c1(c(=cc=cc=1)nc=o))=o * inchi-key: ** pvimspyddgdctg-uhfffaoysa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-725 ==
+
== Metabolite CPD-248 ==
 
* common-name:
 
* common-name:
** 13(s)-hpote
+
** 2-formylaminobenzaldehyde
 
* smiles:
 
* smiles:
** ccc=ccc(c=cc=ccccccccc([o-])=o)oo
+
** c(c1(c(=cc=cc=1)nc=o))=o
 
* inchi-key:
 
* inchi-key:
** uyqgvdxdxbaabn-fqsphkrjsa-m
+
** pvimspyddgdctg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 309.425
+
** 149.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-19]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1321]]
+
* [[INDOLE-23-DIOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=13(s)-hpote}}
+
{{#set: common-name=2-formylaminobenzaldehyde}}
{{#set: inchi-key=inchikey=uyqgvdxdxbaabn-fqsphkrjsa-m}}
+
{{#set: inchi-key=inchikey=pvimspyddgdctg-uhfffaoysa-n}}
{{#set: molecular-weight=309.425}}
+
{{#set: molecular-weight=149.149}}

Revision as of 13:11, 14 January 2021

Metabolite CPD-248

  • common-name:
    • 2-formylaminobenzaldehyde
  • smiles:
    • c(c1(c(=cc=cc=1)nc=o))=o
  • inchi-key:
    • pvimspyddgdctg-uhfffaoysa-n
  • molecular-weight:
    • 149.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality