Difference between revisions of "CU+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * smiles: ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite CU+2 == * common-name: ** cu2+ * smiles: ** [cu++] * inchi-key: ** jpvynhnxodakfh-uhfffaoysa-n * molecular-weight: ** 63.546 == Reaction(...")
 
(4 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HEXANOYL-COA ==
+
== Metabolite CU+2 ==
 
* common-name:
 
* common-name:
** hexanoyl-coa
+
** cu2+
 
* smiles:
 
* smiles:
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [cu++]
 
* inchi-key:
 
* inchi-key:
** oexfmsfodmqepe-hdrqghtbsa-j
+
** jpvynhnxodakfh-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 861.647
+
** 63.546
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.2.19-RXN-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.42.]]
+
* [[3.6.3.4-RXN]]
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
+
* [[Cut1]]
* [[RXN-14277]]
+
* [[ExchangeSeed-CU+2]]
* [[RXN-14278]]
+
* [[TransportSeed-CU+2]]
* [[THIOESTER-RXN[CCO-CYTOSOL]-HEXANOYL-COA/WATER//HEXANOATE/CO-A/PROTON.55.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12559]]
+
* [[3.6.3.4-RXN]]
* [[RXN-14277]]
+
* [[Cut1]]
* [[RXN-14278]]
+
* [[ExchangeSeed-CU+2]]
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
+
* [[TransportSeed-CU+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hexanoyl-coa}}
+
{{#set: common-name=cu2+}}
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
+
{{#set: inchi-key=inchikey=jpvynhnxodakfh-uhfffaoysa-n}}
{{#set: molecular-weight=861.647}}
+
{{#set: molecular-weight=63.546}}

Latest revision as of 11:11, 18 March 2021

Metabolite CU+2

  • common-name:
    • cu2+
  • smiles:
    • [cu++]
  • inchi-key:
    • jpvynhnxodakfh-uhfffaoysa-n
  • molecular-weight:
    • 63.546

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality