Difference between revisions of "CYANCAT-PWY"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Hypoxanthine-In-tRNAs-34s Hypoxanthine-In-tRNAs-34s] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] ==
 * common-name:
-** a hypoxanthine 34 in trnas
+** all-trans-retinol
+* smiles:
+** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
+* inchi-key:
+** fpipgxgpppqfeq-ovsjkpmpsa-n
+* molecular-weight:
+** 286.456
 == Reaction(s) known to consume the compound ==
-* [[RXN-13997]]
+* [[1.3.99.23-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12547]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13997]]
+* [[3.1.1.64-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12575]]
+* [[RXN-12579]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=a hypoxanthine 34 in trnas}}
+{{#set: common-name=all-trans-retinol}}
+{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
+{{#set: molecular-weight=286.456}}