Difference between revisions of "CYANCAT-PWY"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] ==
+== Pathway CYANCAT-PWY ==
+* taxonomic-range:
+** tax-33090
+** tax-2
 * common-name:
-** all-trans-retinol
+** cyanate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
+* [[R524-RXN]]
-* inchi-key:
+* [[RXN0-5224]]
-** fpipgxgpppqfeq-ovsjkpmpsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN0-5222 RXN0-5222]
-** 286.456
+{{#set: taxonomic-range=tax-2|tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=cyanate degradation}}
-* [[1.3.99.23-RXN]]
+{{#set: nb reaction found=2}}
-* [[RETINOL-DEHYDROGENASE-RXN]]
+{{#set: completion rate=0.67}}
-* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+{{#set: nb total reaction=3}}
-* [[RXN-10841]]
-* [[RXN-12547]]
-== Reaction(s) known to produce the compound ==
-* [[3.1.1.64-RXN]]
-* [[RETINOL-DEHYDROGENASE-RXN]]
-* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
-* [[RXN-10841]]
-* [[RXN-12575]]
-* [[RXN-12579]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=all-trans-retinol}}
-{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
-{{#set: molecular-weight=286.456}}