Difference between revisions of "CYCLOARTENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o * inchi-key: ** cao...")
(Created page with "Category:metabolite == Metabolite CYCLOARTENOL == * common-name: ** cycloartenol * smiles: ** cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5)))) *...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-476 ==
+
== Metabolite CYCLOARTENOL ==
 
* common-name:
 
* common-name:
** 4-(2-aminophenyl)-2,4-dioxobutanoate
+
** cycloartenol
 
* smiles:
 
* smiles:
** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
+
** cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
 
* inchi-key:
 
* inchi-key:
** caovwyzqmpnafj-uhfffaoysa-m
+
** onqrkeuaijmulo-coenlipysa-n
 
* molecular-weight:
 
* molecular-weight:
** 206.177
+
** 426.724
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.7-RXN]]
+
* [[RXN-21829]]
 +
* [[RXN-4021]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.7-RXN]]
+
* [[CYCLOARTENOL-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
+
{{#set: common-name=cycloartenol}}
{{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=onqrkeuaijmulo-coenlipysa-n}}
{{#set: molecular-weight=206.177}}
+
{{#set: molecular-weight=426.724}}

Latest revision as of 11:12, 18 March 2021

Metabolite CYCLOARTENOL

  • common-name:
    • cycloartenol
  • smiles:
    • cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
  • inchi-key:
    • onqrkeuaijmulo-coenlipysa-n
  • molecular-weight:
    • 426.724

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality