Difference between revisions of "CYCLOEUCALENOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...") |
(Created page with "Category:metabolite == Metabolite GLYCOL == * common-name: ** ethylene glycol * smiles: ** c(co)o * inchi-key: ** lycaikowrpuztn-uhfffaoysa-n * molecular-weight: ** 62.068...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLYCOL == |
* common-name: | * common-name: | ||
− | ** | + | ** ethylene glycol |
* smiles: | * smiles: | ||
− | ** | + | ** c(co)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** lycaikowrpuztn-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 62.068 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14023]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ethylene glycol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lycaikowrpuztn-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=62.068}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite GLYCOL
- common-name:
- ethylene glycol
- smiles:
- c(co)o
- inchi-key:
- lycaikowrpuztn-uhfffaoysa-n
- molecular-weight:
- 62.068