Difference between revisions of "CYCLOEUCALENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...")
(Created page with "Category:metabolite == Metabolite GLYCOL == * common-name: ** ethylene glycol * smiles: ** c(co)o * inchi-key: ** lycaikowrpuztn-uhfffaoysa-n * molecular-weight: ** 62.068...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-730 ==
+
== Metabolite GLYCOL ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
+
** ethylene glycol
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
+
** c(co)o
 
* inchi-key:
 
* inchi-key:
** bzxzfdkirzbjep-jmtmcxqrsa-m
+
** lycaikowrpuztn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 293.425
+
** 62.068
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
* [[RXN-14023]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}}
+
{{#set: common-name=ethylene glycol}}
{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}
+
{{#set: inchi-key=inchikey=lycaikowrpuztn-uhfffaoysa-n}}
{{#set: molecular-weight=293.425}}
+
{{#set: molecular-weight=62.068}}

Revision as of 13:12, 14 January 2021

Metabolite GLYCOL

  • common-name:
    • ethylene glycol
  • smiles:
    • c(co)o
  • inchi-key:
    • lycaikowrpuztn-uhfffaoysa-n
  • molecular-weight:
    • 62.068

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality