Difference between revisions of "CYS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NUCLEOTIDE-PYROPHOSPHATASE-RXN NUCLEOTIDE-PYROPHOSPHATASE-RXN] == * direction: ** left-to-right * c...")
(Created page with "Category:metabolite == Metabolite CPD-19172 == * common-name: ** (2e,9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NUCLEOTIDE-PYROPHOSPHATASE-RXN NUCLEOTIDE-PYROPHOSPHATASE-RXN] ==
+
== Metabolite CPD-19172 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** nucleotide diphosphatase
+
** (2e,9z)-octadecenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.6.1.9 ec-3.6.1.9]
+
** ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[Nucleoside-Triphosphates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Nucleoside-Monophosphates]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c]
+
** reoymonhghuley-ppsvnwdxsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 1025.937
* Gene: [[SJ12166]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-17776]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ04934]]
+
* [[RXN-17775]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=(2e,9z)-octadecenoyl-coa}}
* Gene: [[SJ22529]]
+
{{#set: inchi-key=inchikey=reoymonhghuley-ppsvnwdxsa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=1025.937}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ19893]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ07337]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ08998]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ19894]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ08856]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01532 R01532]
 
** [http://www.genome.jp/dbget-bin/www_bget?R00056 R00056]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P22413 P22413]
 
** [http://www.uniprot.org/uniprot/Q64610 Q64610]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=nucleotide diphosphatase}}
 
{{#set: ec-number=ec-3.6.1.9}}
 
{{#set: nb gene associated=8}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite CPD-19172

  • common-name:
    • (2e,9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • reoymonhghuley-ppsvnwdxsa-j
  • molecular-weight:
    • 1025.937

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality