Difference between revisions of "CYS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17540 == * common-name: ** dapdiamide b * smiles: ** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** wsfqksibzodgpb-o...") |
(Created page with "Category:metabolite == Metabolite CPD0-903 == * common-name: ** n-ethylsuccinimide * smiles: ** ccn1(c(ccc1=o)=o) * inchi-key: ** ghazcvnukkztlg-uhfffaoysa-n * molecular-w...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-903 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-ethylsuccinimide |
* smiles: | * smiles: | ||
| − | ** | + | ** ccn1(c(ccc1=o)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ghazcvnukkztlg-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 127.143 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-5101]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-ethylsuccinimide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghazcvnukkztlg-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=127.143}} |
Revision as of 13:13, 14 January 2021
Contents
Metabolite CPD0-903
- common-name:
- n-ethylsuccinimide
- smiles:
- ccn1(c(ccc1=o)=o)
- inchi-key:
- ghazcvnukkztlg-uhfffaoysa-n
- molecular-weight:
- 127.143
