Difference between revisions of "CYS-GLY"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02868 == * transcription-direction: ** negative * right-end-position: ** 51305 * left-end-position: ** 45397 * centisome-position: ** 35.36473...") |
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CYS-GLY == |
− | * | + | * common-name: |
− | ** | + | ** l-cysteinyl-glycine |
− | * | + | * smiles: |
− | ** | + | ** c(c([o-])=o)nc(c(cs)[n+])=o |
− | * | + | * inchi-key: |
− | ** | + | ** zukpvrwzdmrieo-vkhmyheasa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 178.206 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-6622]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12618]] | |
− | + | * [[RXN-18092]] | |
− | + | * [[RXN-6601]] | |
− | * [[RXN- | + | * [[RXN-9157]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=l-cysteinyl-glycine}} | |
− | * [[RXN- | + | {{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}} |
− | + | {{#set: molecular-weight=178.206}} | |
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CYS-GLY
- common-name:
- l-cysteinyl-glycine
- smiles:
- c(c([o-])=o)nc(c(cs)[n+])=o
- inchi-key:
- zukpvrwzdmrieo-vkhmyheasa-n
- molecular-weight:
- 178.206