Difference between revisions of "CYSTINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02240 == * transcription-direction: ** negative * right-end-position: ** 215265 * left-end-position: ** 214809 * centisome-position: ** 93.19626...") |
(Created page with "Category:metabolite == Metabolite CYSTINE == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi-key: ** levwyrkdkasidu-imjsidkusa-n *...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CYSTINE == |
− | * | + | * common-name: |
− | ** | + | ** l-cystine |
− | + | * smiles: | |
− | + | ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] | |
− | * | + | * inchi-key: |
− | ** | + | ** levwyrkdkasidu-imjsidkusa-n |
− | + | * molecular-weight: | |
− | + | ** 240.292 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[CYSTHIOCYS-RXN]] | |
− | + | * [[RXN-15128]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=l-cystine}} | |
− | + | {{#set: inchi-key=inchikey=levwyrkdkasidu-imjsidkusa-n}} | |
− | + | {{#set: molecular-weight=240.292}} | |
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CYSTINE
- common-name:
- l-cystine
- smiles:
- c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
- inchi-key:
- levwyrkdkasidu-imjsidkusa-n
- molecular-weight:
- 240.292