Difference between revisions of "CYSTINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7836 == * common-name: ** myristate * smiles: ** cccccccccccccc([o-])=o * inchi-key: ** tunfsrhwotwdnc-uhfffaoysa-m * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CYSTINE == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi-key: ** levwyrkdkasidu-imjsidkusa-n *...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CYSTINE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-cystine |
* smiles: | * smiles: | ||
− | ** | + | ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** levwyrkdkasidu-imjsidkusa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 240.292 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CYSTHIOCYS-RXN]] | ||
+ | * [[RXN-15128]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-cystine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=levwyrkdkasidu-imjsidkusa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=240.292}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CYSTINE
- common-name:
- l-cystine
- smiles:
- c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
- inchi-key:
- levwyrkdkasidu-imjsidkusa-n
- molecular-weight:
- 240.292