Difference between revisions of "CYSTINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 16S-rRNA-guanine-527 == * common-name: ** a guanine527 in 16s rrna == Reaction(s) known to consume the compound == * RXN-11578 == Rea...") |
(Created page with "Category:metabolite == Metabolite CYSTINE == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi-key: ** levwyrkdkasidu-imjsidkusa-n *...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CYSTINE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-cystine |
+ | * smiles: | ||
+ | ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] | ||
+ | * inchi-key: | ||
+ | ** levwyrkdkasidu-imjsidkusa-n | ||
+ | * molecular-weight: | ||
+ | ** 240.292 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[CYSTHIOCYS-RXN]] |
+ | * [[RXN-15128]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-cystine}} |
+ | {{#set: inchi-key=inchikey=levwyrkdkasidu-imjsidkusa-n}} | ||
+ | {{#set: molecular-weight=240.292}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CYSTINE
- common-name:
- l-cystine
- smiles:
- c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
- inchi-key:
- levwyrkdkasidu-imjsidkusa-n
- molecular-weight:
- 240.292