Difference between revisions of "CYSTINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02714 == * transcription-direction: ** negative * right-end-position: ** 235801 * left-end-position: ** 227379 * centisome-position: ** 42.554756...")
(Created page with "Category:metabolite == Metabolite CYSTINE == * common-name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi-key: ** levwyrkdkasidu-imjsidkusa-n *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02714 ==
+
== Metabolite CYSTINE ==
* transcription-direction:
+
* common-name:
** negative
+
** l-cystine
* right-end-position:
+
* smiles:
** 235801
+
** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
* left-end-position:
+
* inchi-key:
** 227379
+
** levwyrkdkasidu-imjsidkusa-n
* centisome-position:
+
* molecular-weight:
** 42.554756   
+
** 240.292
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[CYSTHIOCYS-RXN]]
== Reaction(s) associated ==
+
* [[RXN-15128]]
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=l-cystine}}
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=levwyrkdkasidu-imjsidkusa-n}}
* [[PWY-7511]]
+
{{#set: molecular-weight=240.292}}
** '''7''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=235801}}
 
{{#set: left-end-position=227379}}
 
{{#set: centisome-position=42.554756    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CYSTINE

  • common-name:
    • l-cystine
  • smiles:
    • c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
  • inchi-key:
    • levwyrkdkasidu-imjsidkusa-n
  • molecular-weight:
    • 240.292

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality