Difference between revisions of "CYSTSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HSCN HSCN] == * common-name: ** thiocyanate * smiles: ** c(#n)[s-] * inchi-key: ** zmzdmbwjuhkj...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HSCN HSCN] ==
 
* common-name:
 
* common-name:
** ppgpp
+
** thiocyanate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** c(#n)[s-]
 
* inchi-key:
 
* inchi-key:
** bufllcufnheseh-uuokfmhzsa-i
+
** zmzdmbwjuhkjps-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 598.123
+
** 58.078
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GBDP]]
 
* [[PPGPPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GBDP]]
+
* [[RXN0-6359]]
* [[GDPPYPHOSKIN-RXN]]
+
* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ppgpp}}
+
{{#set: common-name=thiocyanate}}
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
+
{{#set: inchi-key=inchikey=zmzdmbwjuhkjps-uhfffaoysa-m}}
{{#set: molecular-weight=598.123}}
+
{{#set: molecular-weight=58.078}}

Revision as of 09:22, 27 August 2019

Metabolite HSCN

  • common-name:
    • thiocyanate
  • smiles:
    • c(#n)[s-]
  • inchi-key:
    • zmzdmbwjuhkjps-uhfffaoysa-m
  • molecular-weight:
    • 58.078

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality