Difference between revisions of "CYTIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-Alkyl-2-acyl-glycerol-3-phosphate == * common-name: ** a 2-acyl-1-alkyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite CYTIDINE == * common-name: ** cytidine * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o * inchi-key: ** uhdgcwiwmrvcdj-xvfcmesisa-n...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CYTIDINE == |
* common-name: | * common-name: | ||
− | ** | + | ** cytidine |
+ | * smiles: | ||
+ | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o | ||
+ | * inchi-key: | ||
+ | ** uhdgcwiwmrvcdj-xvfcmesisa-n | ||
+ | * molecular-weight: | ||
+ | ** 243.219 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ATCY]] |
+ | * [[ATDTD]] | ||
+ | * [[ATDTDm]] | ||
+ | * [[CYTIDEAM2-RXN]] | ||
+ | * [[DATCY]] | ||
+ | * [[DCTCP]] | ||
+ | * [[DGTCY]] | ||
+ | * [[DTTGY]] | ||
+ | * [[DTTPtm]] | ||
+ | * [[DUTCP]] | ||
+ | * [[GTCY]] | ||
+ | * [[ITCY]] | ||
+ | * [[RXN0-361]] | ||
+ | * [[UTCY]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ATDTM]] |
+ | * [[DTTGY]] | ||
+ | * [[DTTPtm]] | ||
+ | * [[DTTUP]] | ||
+ | * [[RXN-14026]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cytidine}} |
+ | {{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}} | ||
+ | {{#set: molecular-weight=243.219}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CYTIDINE
- common-name:
- cytidine
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
- inchi-key:
- uhdgcwiwmrvcdj-xvfcmesisa-n
- molecular-weight:
- 243.219