Difference between revisions of "CYTIDINE"

Latest revision as of 11:16, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite C3 ==
+== Metabolite CYTIDINE ==
 * common-name:
-** udp-n-acetyl-&alpha;-d-muramoyl-l-alanyl-&gamma;-d-glutamyl-l-lysyl-d-alanyl-d-alanine
+** cytidine
 * smiles:
-** cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
+** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
 * inchi-key:
-** pfmvormcvgoqkr-xncokrrhsa-k
+** uhdgcwiwmrvcdj-xvfcmesisa-n
 * molecular-weight:
-** 1146.922
+** 243.219
 == Reaction(s) known to consume the compound ==
-* [[RXN-8975]]
+* [[ATCY]]
+* [[ATDTD]]
+* [[ATDTDm]]
+* [[CYTIDEAM2-RXN]]
+* [[DATCY]]
+* [[DCTCP]]
+* [[DGTCY]]
+* [[DTTGY]]
+* [[DTTPtm]]
+* [[DUTCP]]
+* [[GTCY]]
+* [[ITCY]]
+* [[RXN0-361]]
+* [[UTCY]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-8975]]
+* [[ATDTM]]
+* [[DTTGY]]
+* [[DTTPtm]]
+* [[DTTUP]]
+* [[RXN-14026]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=udp-n-acetyl-&alpha;-d-muramoyl-l-alanyl-&gamma;-d-glutamyl-l-lysyl-d-alanyl-d-alanine}}
+{{#set: common-name=cytidine}}
-{{#set: inchi-key=inchikey=pfmvormcvgoqkr-xncokrrhsa-k}}
+{{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}}
-{{#set: molecular-weight=1146.922}}
+{{#set: molecular-weight=243.219}}