Difference between revisions of "CYTIDINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed-CU+ ExchangeSeed-CU+] == * direction: ** reversible == Reaction formula == * 1.0 CU+...") |
(Created page with "Category:metabolite == Metabolite CYTIDINE == * common-name: ** cytidine * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o * inchi-key: ** uhdgcwiwmrvcdj-xvfcmesisa-n...") |
||
| (9 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CYTIDINE == |
| − | * | + | * common-name: |
| − | ** | + | ** cytidine |
| − | == Reaction | + | * smiles: |
| − | * | + | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o |
| − | == | + | * inchi-key: |
| − | + | ** uhdgcwiwmrvcdj-xvfcmesisa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 243.219 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | * [[ATCY]] |
| − | {{#set: | + | * [[ATDTD]] |
| − | + | * [[ATDTDm]] | |
| − | + | * [[CYTIDEAM2-RXN]] | |
| − | {{#set: | + | * [[DATCY]] |
| − | + | * [[DCTCP]] | |
| − | + | * [[DGTCY]] | |
| + | * [[DTTGY]] | ||
| + | * [[DTTPtm]] | ||
| + | * [[DUTCP]] | ||
| + | * [[GTCY]] | ||
| + | * [[ITCY]] | ||
| + | * [[RXN0-361]] | ||
| + | * [[UTCY]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[ATDTM]] | ||
| + | * [[DTTGY]] | ||
| + | * [[DTTPtm]] | ||
| + | * [[DTTUP]] | ||
| + | * [[RXN-14026]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=cytidine}} | ||
| + | {{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}} | ||
| + | {{#set: molecular-weight=243.219}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CYTIDINE
- common-name:
- cytidine
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
- inchi-key:
- uhdgcwiwmrvcdj-xvfcmesisa-n
- molecular-weight:
- 243.219
