Difference between revisions of "CYTOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...") |
(Created page with "Category:metabolite == Metabolite CPD-401 == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) * inchi-key: ** myyiahxivfadcu-qmmmgpobsa-n * mo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-401 == |
* common-name: | * common-name: | ||
| − | ** | + | ** anserine |
* smiles: | * smiles: | ||
| − | ** | + | ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** myyiahxivfadcu-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 240.261 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[X-METHYL-HIS-DIPEPTIDASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CARNOSINE-N-METHYLTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=anserine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=myyiahxivfadcu-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=240.261}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-401
- common-name:
- anserine
- smiles:
- cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o)
- inchi-key:
- myyiahxivfadcu-qmmmgpobsa-n
- molecular-weight:
- 240.261
