Difference between revisions of "Carbo-me-ur-34-tRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * smiles: ** c1(op([o-])([o-])=o)(c(op(...")
(Created page with "Category:metabolite == Metabolite carbo-me-ur-34-tRNA == * common-name: ** a carboxymethyluridine34 in trna == Reaction(s) known to consume the compound == * RXN-12461...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11939 ==
+
== Metabolite carbo-me-ur-34-tRNA ==
 
* common-name:
 
* common-name:
** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
+
** a carboxymethyluridine34 in trna
* smiles:
 
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
 
* inchi-key:
 
** hhqooerqsfjgep-zsiqdkgesa-a
 
* molecular-weight:
 
** 805.885
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10976]]
+
* [[RXN-12461]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10973]]
 
* [[RXN-10976]]
 
* [[RXN-10979]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=a carboxymethyluridine34 in trna}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}}
 
{{#set: molecular-weight=805.885}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite carbo-me-ur-34-tRNA

  • common-name:
    • a carboxymethyluridine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality