Difference between revisions of "Carbo-me-ur-34-tRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * smiles: ** c1(op([o-])([o-])=o)(c(op(...")
(Created page with "Category:metabolite == Metabolite CPD-7036 == * common-name: ** 3-methylthiopropanal * smiles: ** csccc=o * inchi-key: ** cluwowrthnnbbu-uhfffaoysa-n * molecular-weight: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11939 ==
+
== Metabolite CPD-7036 ==
 
* common-name:
 
* common-name:
** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
+
** 3-methylthiopropanal
 
* smiles:
 
* smiles:
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
+
** csccc=o
 
* inchi-key:
 
* inchi-key:
** hhqooerqsfjgep-zsiqdkgesa-a
+
** cluwowrthnnbbu-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 805.885
+
** 104.167
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10976]]
+
* [[RXN-7706]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10973]]
 
* [[RXN-10976]]
 
* [[RXN-10979]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}}
+
{{#set: common-name=3-methylthiopropanal}}
{{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}}
+
{{#set: inchi-key=inchikey=cluwowrthnnbbu-uhfffaoysa-n}}
{{#set: molecular-weight=805.885}}
+
{{#set: molecular-weight=104.167}}

Revision as of 13:11, 14 January 2021

Metabolite CPD-7036

  • common-name:
    • 3-methylthiopropanal
  • smiles:
    • csccc=o
  • inchi-key:
    • cluwowrthnnbbu-uhfffaoysa-n
  • molecular-weight:
    • 104.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality