Difference between revisions of "Carboxyadenylated-MPT-synthases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-DEHYDROGLUCONATE == * common-name: ** 5-dehydro-d-gluconate * smiles: ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** izsrjdgcgrauar-...") |
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OLEOYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** oleoyl-coa |
* smiles: | * smiles: | ||
− | ** c(o)c(=o)c(o) | + | ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xduhqpoxluavee-bpmmelmssa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1027.953 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13322]] |
+ | * [[RXN-15036]] | ||
+ | * [[RXN-15043]] | ||
+ | * [[RXN-15044]] | ||
+ | * [[RXN-15045]] | ||
+ | * [[RXN-15090]] | ||
+ | * [[RXN-17775]] | ||
+ | * [[RXN-9601]] | ||
+ | * [[RXN-9666]] | ||
+ | * [[RXN-9670]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.14.19.1-RXN]] |
+ | * [[RXN-15036]] | ||
+ | * [[RXN-9644]] | ||
+ | * [[RXN-9670]] | ||
+ | * [[RXN0-7239]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=oleoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1027.953}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite OLEOYL-COA
- common-name:
- oleoyl-coa
- smiles:
- ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xduhqpoxluavee-bpmmelmssa-j
- molecular-weight:
- 1027.953