Difference between revisions of "Carboxyadenylated-MPT-synthases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-DEHYDROGLUCONATE == * common-name: ** 5-dehydro-d-gluconate * smiles: ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** izsrjdgcgrauar-...") |
(Created page with "Category:metabolite == Metabolite Carboxyadenylated-MPT-synthases == * common-name: ** a carboxy-adenylated [small subunit of molybdopterin synthase] == Reaction(s) known...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Carboxyadenylated-MPT-synthases == |
* common-name: | * common-name: | ||
| − | ** | + | ** a carboxy-adenylated [small subunit of molybdopterin synthase] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12473]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11361]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a carboxy-adenylated [small subunit of molybdopterin synthase]}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Carboxyadenylated-MPT-synthases
- common-name:
- a carboxy-adenylated [small subunit of molybdopterin synthase]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a carboxy-adenylated [small subunit of molybdopterin synthase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
