Difference between revisions of "Carboxylates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TTP ==
+
== Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* common-name:
 
* common-name:
** dttp
+
** 3,8-divinyl protochlorophyllide a
* smiles:
 
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
 
* inchi-key:
 
** nhvnxkfizysceb-xlpzgreqsa-j
 
 
* molecular-weight:
 
* molecular-weight:
** 478.139
+
** 608.935
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTTGY]]
+
* [[RXN-5285]]
* [[DTTPtm]]
+
* [[RXN1F-72]]
* [[DTTUP]]
 
* [[RXN-14200]]
 
* [[RXN0-5107]]
 
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDTD]]
+
* [[RXN1F-72]]
* [[ATDTDm]]
 
* [[DTDPKIN-RXN]]
 
* [[DTTPtm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dttp}}
+
{{#set: common-name=3,8-divinyl protochlorophyllide a}}
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
+
{{#set: molecular-weight=608.935}}
{{#set: molecular-weight=478.139}}
 

Revision as of 08:31, 15 March 2021

Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)=c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • common-name:
    • 3,8-divinyl protochlorophyllide a
  • molecular-weight:
    • 608.935

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality