Difference between revisions of "Carotenoid-beta-end-group"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * molecular-weig...")
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite ASN ==
+
== Metabolite FRUCTOSE-6P ==
 
* common-name:
 
* common-name:
−
** l-asparagine
+
** β-d-fructofuranose 6-phosphate
 
* smiles:
 
* smiles:
−
** c(cc(c(=o)[o-])[n+])(n)=o
+
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
−
** dcxyfedjocdnaf-reohclbhsa-n
+
** bgwgxpapygqalx-arqdhwqxsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 132.119
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[ASPARAGHYD-RXN]]
+
* [[2.7.1.90-RXN]]
−
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
+
* [[2TRANSKETO-RXN]]
−
* [[biomass_rxn]]
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PFK_]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ASNSYNA-RXN]]
+
* [[2.7.1.90-RXN]]
−
* [[ASNSYNB-RXN]]
+
* [[2TRANSKETO-RXN]]
−
* [[RXN-12460]]
+
* [[3.1.3.46-RXN]]
−
* [[RXN0-6982]]
+
* [[F16BDEPHOS-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=l-asparagine}}
+
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
−
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
−
{{#set: molecular-weight=132.119}}
+
{{#set: molecular-weight=258.121}}

Revision as of 11:19, 15 January 2021

Metabolite FRUCTOSE-6P

  • common-name:
    • β-d-fructofuranose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
  • inchi-key:
    • bgwgxpapygqalx-arqdhwqxsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Carotenoid-beta-end-group&oldid=113646"