Difference between revisions of "Carotenoid-psi-end-group"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12118 == * common-name: ** demethylmenaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1...")
(Created page with "Category:metabolite == Metabolite Carotenoid-psi-end-group == * common-name: ** a carotenoid ψ-end group == Reaction(s) known to consume the compound == * [[RXN-12496]...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12118 ==
+
== Metabolite Carotenoid-psi-end-group ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-9
+
** a carotenoid ψ-end group
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
** wjuvwmhfghnqjz-rnfptggasa-n
 
* molecular-weight:
 
** 773.236
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9205]]
+
* [[RXN-12496]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-9}}
+
{{#set: common-name=a carotenoid ψ-end group}}
{{#set: inchi-key=inchikey=wjuvwmhfghnqjz-rnfptggasa-n}}
 
{{#set: molecular-weight=773.236}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Carotenoid-psi-end-group

  • common-name:
    • a carotenoid ψ-end group

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality