Difference between revisions of "Carotenoid-psi-end-group"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12118 == * common-name: ** demethylmenaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1...")
(Created page with "Category:metabolite == Metabolite Reduced-hemoproteins == * common-name: ** a reduced hemoprotein == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12118 ==
+
== Metabolite Reduced-hemoproteins ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-9
+
** a reduced hemoprotein
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 
* inchi-key:
 
** wjuvwmhfghnqjz-rnfptggasa-n
 
* molecular-weight:
 
** 773.236
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9205]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-9}}
+
{{#set: common-name=a reduced hemoprotein}}
{{#set: inchi-key=inchikey=wjuvwmhfghnqjz-rnfptggasa-n}}
 
{{#set: molecular-weight=773.236}}
 

Revision as of 15:25, 5 January 2021

Metabolite Reduced-hemoproteins

  • common-name:
    • a reduced hemoprotein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality