Difference between revisions of "Category:Metabolite"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...")
(Created page with "{{#ask: Category:reaction reconstruction tool::pantograph | ?common-name | ?ec-number | ?reconstruction category | ?reconstruction source | ?reconstruction comment | ?...")
Line 1: Line 1:
[[Category:metabolite]]
+
{{#ask: [[Category:reaction]] [[reconstruction tool::pantograph]]
== Metabolite G3P ==
+
| ?common-name
* common-name:
+
| ?ec-number
** 3-phospho-d-glycerate
+
| ?reconstruction category
* smiles:
+
| ?reconstruction source
** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
+
| ?reconstruction comment
* inchi-key:
+
| ?nb gene associated
** osjppgntcrnqqc-uwtatzphsa-k
+
| ?nb pathway associated
* molecular-weight:
+
}}
** 183.034
 
== Reaction(s) known to consume the compound ==
 
* [[3PGAREARR-RXN]]
 
* [[PGLYCDEHYDROG-RXN]]
 
* [[PHOSGLYPHOS-RXN]]
 
* [[RXN-15511]]
 
* [[RXN-15513]]
 
* [[RXN-17276]]
 
== Reaction(s) known to produce the compound ==
 
* [[3PGAREARR-RXN]]
 
* [[GLY3KIN-RXN]]
 
* [[PGLYCDEHYDROG-RXN]]
 
* [[PHOSGLYPHOS-RXN]]
 
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
 
* [[RXN-15511]]
 
* [[RXN-15513]]
 
* [[RXN-17274]]
 
* [[RXN-3443]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3-phospho-d-glycerate}}
 
{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
 
{{#set: molecular-weight=183.034}}
 

Revision as of 18:59, 14 January 2021

Pages in category "Metabolite"

The following 200 pages are in this category, out of 3,246 total.

(previous page) (next page)

F

(previous page) (next page)