Difference between revisions of "Category:Pathway"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...")
(Created page with "Category:metabolite == Metabolite CPD-15016 == * common-name: ** (4s)-4-hydroxy-2-oxoglutarate * smiles: ** c(c(=o)c([o-])=o)c(c([o-])=o)o * inchi-key: ** wxskvkpsmahcsg-r...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-CITRULLINE ==
+
== Metabolite CPD-15016 ==
 
* common-name:
 
* common-name:
** l-citrulline
+
** (4s)-4-hydroxy-2-oxoglutarate
 
* smiles:
 
* smiles:
** c(nc(n)=o)ccc([n+])c(=o)[o-]
+
** c(c(=o)c([o-])=o)c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** rhgklrlohdjjdr-bypyzucnsa-n
+
** wxskvkpsmahcsg-reohclbhsa-l
 
* molecular-weight:
 
* molecular-weight:
** 175.187
+
** 160.083
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARGSUCCINSYN-RXN]]
+
* [[RXN-13990]]
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[RXN-13482]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHYLARGININASE-RXN]]
+
* [[RXN-13990]]
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[RXN-13482]]
 
* [[RXN-13565]]
 
* [[RXN-7933]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-citrulline}}
+
{{#set: common-name=(4s)-4-hydroxy-2-oxoglutarate}}
{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
+
{{#set: inchi-key=inchikey=wxskvkpsmahcsg-reohclbhsa-l}}
{{#set: molecular-weight=175.187}}
+
{{#set: molecular-weight=160.083}}

Revision as of 11:20, 15 January 2021

Metabolite CPD-15016

  • common-name:
    • (4s)-4-hydroxy-2-oxoglutarate
  • smiles:
    • c(c(=o)c([o-])=o)c(c([o-])=o)o
  • inchi-key:
    • wxskvkpsmahcsg-reohclbhsa-l
  • molecular-weight:
    • 160.083

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Pages in category "Pathway"

The following 200 pages are in this category, out of 1,391 total.

(previous page) (next page)

P

(previous page) (next page)