Difference between revisions of "Category:Pathway"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...")
(Created page with "{{#ask: Category:pathway | ?common-name | ?nb reaction found | ?nb total reaction | ?completion rate |sort=completion rate, nb total reaction |order=descending }}")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
{{#ask: [[Category:pathway]]
−
== Metabolite L-CITRULLINE ==
+
| ?common-name
−
* common-name:
+
| ?nb reaction found
−
** l-citrulline
+
| ?nb total reaction
−
* smiles:
+
| ?completion rate
−
** c(nc(n)=o)ccc([n+])c(=o)[o-]
+
|sort=completion rate, nb total reaction
−
* inchi-key:
+
|order=descending
−
** rhgklrlohdjjdr-bypyzucnsa-n
+
}}
−
* molecular-weight:
 
−
** 175.187
 
−
== Reaction(s) known to consume the compound ==
 
−
* [[ARGSUCCINSYN-RXN]]
 
−
* [[ORNCARBAMTRANSFER-RXN]]
 
−
* [[RXN-13482]]
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[DIMETHYLARGININASE-RXN]]
 
−
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
−
* [[ORNCARBAMTRANSFER-RXN]]
 
−
* [[RXN-13482]]
 
−
* [[RXN-13565]]
 
−
* [[RXN-7933]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=l-citrulline}}
 
−
{{#set: inchi-key=inchikey=rhgklrlohdjjdr-bypyzucnsa-n}}
 
−
{{#set: molecular-weight=175.187}}
 

Latest revision as of 11:18, 18 March 2021

 Common-nameNb reaction foundNb total reactionCompletion rate
PWY-5966Fatty acid biosynthesis initiation ii2N.aN.a
PWY66-422D-galactose degradation v (leloir pathway)5N.aN.a
PWY-3221Dtdp-l-rhamnose biosynthesis ii1N.aN.a
PWY-5664Erythro-tetrahydrobiopterin biosynthesis ii2N.aN.a
PWY-7233Ubiquinol-6 bypass biosynthesis (eukaryotic)3N.aN.a
PWY-7243Pectin degradation i1N.aN.a
PWY-7235Superpathway of ubiquinol-6 biosynthesis (eukaryotic)2N.aN.a
PWY-6115Avenacin biosynthesis, initial reactions1N.aN.a
PWY-6196D-serine metabolism1N.aN.a
PWY0-661Prpp biosynthesis ii1N.aN.a
PWY-6305Putrescine biosynthesis iv4N.aN.a
PWY0-1534Hydrogen sulfide biosynthesis i1N.aN.a
P224-PWYSulfate reduction v (dissimilatory, to thiosulfate)2N.aN.a
PWY-82382N.aN.a
PWY-5965Fatty acid biosynthesis initiation iii1N.aN.a
PWY0-1415Superpathway of heme b biosynthesis from uroporphyrinogen-iii4N.aN.a
PWY66-4Cholesterol biosynthesis iii (via desmosterol)1243.0
PWY-5750Itaconate biosynthesis321.5
PWY-7432L-phenylalanine biosynthesis iii (cytosolic, plants)321.5
PWY-4981L-proline biosynthesis ii (from arginine)321.5
PWY-3341L-proline biosynthesis iii431.33
PWY-7219Adenosine ribonucleotides de novo biosynthesis431.33
PWY-7118Chitin degradation to ethanol541.25
PWY-5913Partial tca cycle (obligate autotrophs)1081.25
PWY-6163Chorismate biosynthesis from 3-dehydroquinate651.2
PWY-882L-ascorbate biosynthesis i (l-galactose pathway)651.2
PWY-6823Molybdenum cofactor biosynthesis761.17
PWY-6969Tca cycle v (2-oxoglutarate:ferredoxin oxidoreductase)1091.11
P105-PWYTca cycle iv (2-oxoglutarate decarboxylase)1091.11
PWY0-1305L-glutamate degradation ix (via 4-aminobutanoate)111.0
PWY0-1299Arginine dependent acid resistance111.0
PWY-1001Cellulose biosynthesis111.0
PWY-5172Acetyl-coa biosynthesis iii (from citrate)111.0
COLANSYN-PWYColanic acid building blocks biosynthesis111.0
PWY-6785Hydrogen production viii111.0
PWY-6158Creatine-phosphate biosynthesis111.0
ALANINE-SYN2-PWYL-alanine biosynthesis ii111.0
PWY-7731Superpathway of photosynthetic hydrogen production111.0
PWY-6132Lanosterol biosynthesis111.0
PWY-5115Gdp-l-galactose biosynthesis111.0
PWY-67731,3-β-d-glucan biosynthesis111.0
PWY-7845Heme degradation ii111.0
PWY-5516Xylose degradation ii111.0
PWY-5963Thio-molybdenum cofactor biosynthesis111.0
PWY-5951(r,r)-butanediol biosynthesis111.0
GLUGLNSYN-PWYL-glutamate biosynthesis iv111.0
ASPARAGINESYN-PWYL-asparagine biosynthesis ii111.0
PWY-6348Phosphate acquisition111.0
ASPARAGINE-DEG1-PWYL-asparagine degradation i111.0
MANNIDEG-PWYMannitol degradation i111.0
... further results

Pages in category "Pathway"

The following 200 pages are in this category, out of 1,391 total.

(previous page) (next page)

P

G

O

H

T

A

M

V

C

S

(previous page) (next page)
Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Category:Pathway&oldid=139838"