Difference between revisions of "Cerebrosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19339 == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) * inc...") |
(Created page with "Category:metabolite == Metabolite Cerebrosides == * common-name: ** a cerebroside == Reaction(s) known to consume the compound == * GALACTOSYLCERAMIDE-SULFOTRANSFERASE-R...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Cerebrosides == |
* common-name: | * common-name: | ||
− | ** | + | ** a cerebroside |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a cerebroside}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Cerebrosides
- common-name:
- a cerebroside