Difference between revisions of "Cerotoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16954 == * common-name: ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate * smiles: ** cc2(c(c(c)op(=o)([...")
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16954 ==
+
== Metabolite Cerotoyl-ACPs ==
 
* common-name:
 
* common-name:
** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate
+
** a cerotoyl-[acp]
* smiles:
 
** cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
 
* inchi-key:
 
** pjdxuyncnwfpcz-iuyqgcfvsa-k
 
* molecular-weight:
 
** 380.17
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15733]]
+
* [[RXN-10062]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate}}
+
{{#set: common-name=a cerotoyl-[acp]}}
{{#set: inchi-key=inchikey=pjdxuyncnwfpcz-iuyqgcfvsa-k}}
 
{{#set: molecular-weight=380.17}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Cerotoyl-ACPs

  • common-name:
    • a cerotoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cerotoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.